About N-methylmethanamine;bis(methyl 4-(methylamino)-4-oxobutanoate)
N-methylmethanamine;bis(methyl 4-(methylamino)-4-oxobutanoate) (PubChem CID 90688519) has the molecular formula C14H29N3O6
and a molecular weight of 335.40 g/mol. Its IUPAC name is N-methylmethanamine;bis(methyl 4-(methylamino)-4-oxobutanoate).
Molecular Properties
| Compound Name | N-methylmethanamine;bis(methyl 4-(methylamino)-4-oxobutanoate) |
| PubChem CID | 90688519 |
| Molecular Formula | C14H29N3O6 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | N-methylmethanamine;bis(methyl 4-(methylamino)-4-oxobutanoate) |
| SMILES | CNC.CNC(=O)CCC(=O)OC.CNC(=O)CCC(=O)OC |
| InChI | InChI=1S/2C6H11NO3.C2H7N/c2*1-7-5(8)3-4-6(9)10-2;1-3-2/h2*3-4H2,1-2H3,(H,7,8);3H,1-2H3 |
| InChIKey | BAYVCALJAZMIMA-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-methylmethanamine;bis(methyl 4-(methylamino)-4-oxobutanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylmethanamine;bis(methyl 4-(methylamino)-4-oxobutanoate)?
The IUPAC name of N-methylmethanamine;bis(methyl 4-(methylamino)-4-oxobutanoate) (CID 90688519) is N-methylmethanamine;bis(methyl 4-(methylamino)-4-oxobutanoate).
What is the SMILES notation for N-methylmethanamine;bis(methyl 4-(methylamino)-4-oxobutanoate)?
The canonical SMILES for N-methylmethanamine;bis(methyl 4-(methylamino)-4-oxobutanoate) is CNC.CNC(=O)CCC(=O)OC.CNC(=O)CCC(=O)OC.
What is the InChIKey of N-methylmethanamine;bis(methyl 4-(methylamino)-4-oxobutanoate)?
The InChIKey is BAYVCALJAZMIMA-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H11NO3.C2H7N/c2*1-7-5(8)3-4-6(9)10-2;1-3-2/h2*3-4H2,1-2H3,(H,7,8);3H,1-2H3.
What are the key properties of N-methylmethanamine;bis(methyl 4-(methylamino)-4-oxobutanoate)?
N-methylmethanamine;bis(methyl 4-(methylamino)-4-oxobutanoate) has a molecular weight of 335.40 g/mol, XLogP of -0.79, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylmethanamine;bis(methyl 4-(methylamino)-4-oxobutanoate) is sourced from PubChem (CID 90688519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).