C9H16N2O4 — CID 10798751
methyl 5-[[2-(methylamino)-2-oxoethyl]amino]-5-oxopentanoate (PubChem CID 10798751) has the molecular formula C9H16N2O4 and a molecular weight of 216.24 g/mol. Its IUPAC name is methyl 5-[[2-(methylamino)-2-oxoethyl]amino]-5-oxopentanoate.
| Compound Name | methyl 5-[[2-(methylamino)-2-oxoethyl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 10798751 |
| Molecular Formula | C9H16N2O4 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | methyl 5-[[2-(methylamino)-2-oxoethyl]amino]-5-oxopentanoate |
| SMILES | CNC(=O)CNC(=O)CCCC(=O)OC |
| InChI | InChI=1S/C9H16N2O4/c1-10-8(13)6-11-7(12)4-3-5-9(14)15-2/h3-6H2,1-2H3,(H,10,13)(H,11,12) |
| InChIKey | HTABJOFKMICYJZ-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |