C11H20BrN3O3 — CID 134550363
6-[(2-bromoacetyl)amino]-N-[2-(methylamino)-2-oxoethyl]hexanamide (PubChem CID 134550363) has the molecular formula C11H20BrN3O3 and a molecular weight of 322.20 g/mol. Its IUPAC name is 6-[(2-bromoacetyl)amino]-N-[2-(methylamino)-2-oxoethyl]hexanamide.
| Compound Name | 6-[(2-bromoacetyl)amino]-N-[2-(methylamino)-2-oxoethyl]hexanamide |
|---|---|
| PubChem CID | 134550363 |
| Molecular Formula | C11H20BrN3O3 |
| Molecular Weight | 322.20 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 6-[(2-bromoacetyl)amino]-N-[2-(methylamino)-2-oxoethyl]hexanamide |
| SMILES | CNC(=O)CNC(=O)CCCCCNC(=O)CBr |
| InChI | InChI=1S/C11H20BrN3O3/c1-13-11(18)8-15-9(16)5-3-2-4-6-14-10(17)7-12/h2-8H2,1H3,(H,13,18)(H,14,17)(H,15,16) |
| InChIKey | UACWGINQCMEEMO-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.20 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|