C12H21NO4 — CID 77231289
methyl 5-[(3,3-dimethyl-2-oxobutyl)amino]-5-oxopentanoate (PubChem CID 77231289) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is methyl 5-[(3,3-dimethyl-2-oxobutyl)amino]-5-oxopentanoate.
| Compound Name | methyl 5-[(3,3-dimethyl-2-oxobutyl)amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 77231289 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | methyl 5-[(3,3-dimethyl-2-oxobutyl)amino]-5-oxopentanoate |
| SMILES | COC(=O)CCCC(=O)NCC(=O)C(C)(C)C |
| InChI | InChI=1S/C12H21NO4/c1-12(2,3)9(14)8-13-10(15)6-5-7-11(16)17-4/h5-8H2,1-4H3,(H,13,15) |
| InChIKey | ADLGJOWURNWVQY-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |