C12H20N2O5 — CID 157367237
methyl 6-[(5-amino-4-oxopentanoyl)amino]-5-oxohexanoate (PubChem CID 157367237) has the molecular formula C12H20N2O5 and a molecular weight of 272.30 g/mol. Its IUPAC name is methyl 6-[(5-amino-4-oxopentanoyl)amino]-5-oxohexanoate.
| Compound Name | methyl 6-[(5-amino-4-oxopentanoyl)amino]-5-oxohexanoate |
|---|---|
| PubChem CID | 157367237 |
| Molecular Formula | C12H20N2O5 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | methyl 6-[(5-amino-4-oxopentanoyl)amino]-5-oxohexanoate |
| SMILES | COC(=O)CCCC(=O)CNC(=O)CCC(=O)CN |
| InChI | InChI=1S/C12H20N2O5/c1-19-12(18)4-2-3-10(16)8-14-11(17)6-5-9(15)7-13/h2-8,13H2,1H3,(H,14,17) |
| InChIKey | GNLJAOCPMQSWCN-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |