C33H56N4O14 — CID 157116767
tert-butyl 2-[(5-amino-4-oxopentanoyl)amino]acetate;6-methoxy-6-oxohexanoic acid;methyl 6-[[2,5-dioxo-5-(2-oxopropylamino)pentyl]amino]-6-oxohexanoate (PubChem CID 157116767) has the molecular formula C33H56N4O14 and a molecular weight of 732.82 g/mol. Its IUPAC name is tert-butyl 2-[(5-amino-4-oxopentanoyl)amino]acetate;6-methoxy-6-oxohexanoic acid;methyl 6-[[2,5-dioxo-5-(2-oxopropylamino)pentyl]amino]-6-oxohexanoate.
| Compound Name | tert-butyl 2-[(5-amino-4-oxopentanoyl)amino]acetate;6-methoxy-6-oxohexanoic acid;methyl 6-[[2,5-dioxo-5-(2-oxopropylamino)pentyl]amino]-6-oxohexanoate |
|---|---|
| PubChem CID | 157116767 |
| Molecular Formula | C33H56N4O14 |
| Molecular Weight | 732.82 g/mol |
| Exact Mass | 732.38 |
| IUPAC Name | tert-butyl 2-[(5-amino-4-oxopentanoyl)amino]acetate;6-methoxy-6-oxohexanoic acid;methyl 6-[[2,5-dioxo-5-(2-oxopropylamino)pentyl]amino]-6-oxohexanoate |
| SMILES | CC(C)(C)OC(=O)CNC(=O)CCC(=O)CN.COC(=O)CCCCC(=O)NCC(=O)CCC(=O)NCC(C)=O.COC(=O)CCCCC(=O)O |
| InChI | InChI=1S/C15H24N2O6.C11H20N2O4.C7H12O4/c1-11(18)9-16-14(21)8-7-12(19)10-17-13(20)5-3-4-6-15(22)23-2;1-11(2,3)17-10(16)7-13-9(15)5-4-8(14)6-12;1-11-7(10)5-3-2-4-6(8)9/h3-10H2,1-2H3,(H,16,21)(H,17,20);4-7,12H2,1-3H3,(H,13,15);2-5H2,1H3,(H,8,9) |
| InChIKey | AHMPHRLJDWLHIM-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 280.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.82 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|