C18H30N2O8 — CID 167666613
methyl 4-oxo-4-(3-oxobutan-2-ylamino)butanoate (PubChem CID 167666613) has the molecular formula C18H30N2O8 and a molecular weight of 402.44 g/mol. Its IUPAC name is methyl 4-oxo-4-(3-oxobutan-2-ylamino)butanoate.
| Compound Name | methyl 4-oxo-4-(3-oxobutan-2-ylamino)butanoate |
|---|---|
| PubChem CID | 167666613 |
| Molecular Formula | C18H30N2O8 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | methyl 4-oxo-4-(3-oxobutan-2-ylamino)butanoate |
| SMILES | COC(=O)CCC(=O)NC(C)C(C)=O.COC(=O)CCC(=O)NC(C)C(C)=O |
| InChI | InChI=1S/2C9H15NO4/c2*1-6(7(2)11)10-8(12)4-5-9(13)14-3/h2*6H,4-5H2,1-3H3,(H,10,12) |
| InChIKey | SSTOSAKCAUWWOK-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |