C10H16ClNO2S — CID 144809276
(2E,4Z)-6-chloro-N,N,5-trimethylhepta-2,4,6-triene-3-sulfonamide (PubChem CID 144809276) has the molecular formula C10H16ClNO2S and a molecular weight of 249.76 g/mol. Its IUPAC name is (2E,4Z)-6-chloro-N,N,5-trimethylhepta-2,4,6-triene-3-sulfonamide.
| Compound Name | (2E,4Z)-6-chloro-N,N,5-trimethylhepta-2,4,6-triene-3-sulfonamide |
|---|---|
| PubChem CID | 144809276 |
| Molecular Formula | C10H16ClNO2S |
| Molecular Weight | 249.76 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | (2E,4Z)-6-chloro-N,N,5-trimethylhepta-2,4,6-triene-3-sulfonamide |
| SMILES | C=C(Cl)/C(C)=C\C(=C/C)S(=O)(=O)N(C)C |
| InChI | InChI=1S/C10H16ClNO2S/c1-6-10(7-8(2)9(3)11)15(13,14)12(4)5/h6-7H,3H2,1-2,4-5H3/b8-7-,10-6+ |
| InChIKey | ZWKVWLCRNVYWCB-SDHBEMGISA-N |
| XLogP | 2.48 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.76 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|