C10H12Cl2O2S — CID 154431203
1-chloro-1-(1-chloro-3-methylbuta-1,3-dienyl)sulfonyl-3-methylbuta-1,3-diene (PubChem CID 154431203) has the molecular formula C10H12Cl2O2S and a molecular weight of 267.18 g/mol. Its IUPAC name is 1-chloro-1-(1-chloro-3-methylbuta-1,3-dienyl)sulfonyl-3-methylbuta-1,3-diene.
| Compound Name | 1-chloro-1-(1-chloro-3-methylbuta-1,3-dienyl)sulfonyl-3-methylbuta-1,3-diene |
|---|---|
| PubChem CID | 154431203 |
| Molecular Formula | C10H12Cl2O2S |
| Molecular Weight | 267.18 g/mol |
| Exact Mass | 265.99 |
| IUPAC Name | 1-chloro-1-(1-chloro-3-methylbuta-1,3-dienyl)sulfonyl-3-methylbuta-1,3-diene |
| SMILES | C=C(C)C=C(Cl)S(=O)(=O)C(Cl)=CC(=C)C |
| InChI | InChI=1S/C10H12Cl2O2S/c1-7(2)5-9(11)15(13,14)10(12)6-8(3)4/h5-6H,1,3H2,2,4H3 |
| InChIKey | HDYGZSRBTIXFQY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.18 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|