C10H11ClO2 — CID 123443790
4-chloro-3,6-dimethylideneoct-4-ene-2,7-dione (PubChem CID 123443790) has the molecular formula C10H11ClO2 and a molecular weight of 198.65 g/mol. Its IUPAC name is 4-chloro-3,6-dimethylideneoct-4-ene-2,7-dione.
| Compound Name | 4-chloro-3,6-dimethylideneoct-4-ene-2,7-dione |
|---|---|
| PubChem CID | 123443790 |
| Molecular Formula | C10H11ClO2 |
| Molecular Weight | 198.65 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | 4-chloro-3,6-dimethylideneoct-4-ene-2,7-dione |
| SMILES | C=C(C=C(Cl)C(=C)C(C)=O)C(C)=O |
| InChI | InChI=1S/C10H11ClO2/c1-6(8(3)12)5-10(11)7(2)9(4)13/h5H,1-2H2,3-4H3 |
| InChIKey | UHGKDOIMKBNZCU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.65 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|