C9H11ClO2 — CID 166818002
(3E)-4-chloro-6-methyl-2-methylidenehepta-3,5-dienoic acid (PubChem CID 166818002) has the molecular formula C9H11ClO2 and a molecular weight of 186.64 g/mol. Its IUPAC name is (3E)-4-chloro-6-methyl-2-methylidenehepta-3,5-dienoic acid.
| Compound Name | (3E)-4-chloro-6-methyl-2-methylidenehepta-3,5-dienoic acid |
|---|---|
| PubChem CID | 166818002 |
| Molecular Formula | C9H11ClO2 |
| Molecular Weight | 186.64 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | (3E)-4-chloro-6-methyl-2-methylidenehepta-3,5-dienoic acid |
| SMILES | C=C(/C=C(/Cl)C=C(C)C)C(=O)O |
| InChI | InChI=1S/C9H11ClO2/c1-6(2)4-8(10)5-7(3)9(11)12/h4-5H,3H2,1-2H3,(H,11,12)/b8-5+ |
| InChIKey | HNEGXLJSFSZEJT-VMPITWQZSA-N |
| XLogP | 2.72 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.64 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|