C6H8ClNO — CID 88966274
(2E)-4-chloro-2-methylpenta-2,4-dienamide (PubChem CID 88966274) has the molecular formula C6H8ClNO and a molecular weight of 145.59 g/mol. Its IUPAC name is (2E)-4-chloro-2-methylpenta-2,4-dienamide.
| Compound Name | (2E)-4-chloro-2-methylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 88966274 |
| Molecular Formula | C6H8ClNO |
| Molecular Weight | 145.59 g/mol |
| Exact Mass | 145.03 |
| IUPAC Name | (2E)-4-chloro-2-methylpenta-2,4-dienamide |
| SMILES | C=C(Cl)/C=C(\C)C(N)=O |
| InChI | InChI=1S/C6H8ClNO/c1-4(6(8)9)3-5(2)7/h3H,2H2,1H3,(H2,8,9)/b4-3+ |
| InChIKey | MGZUVVQVMLVPIH-ONEGZZNKSA-N |
| XLogP | 1.17 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.59 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|