C8H14FNO2S — CID 90944446
4-fluoro-N,N-dimethylhexa-2,4-diene-3-sulfonamide (PubChem CID 90944446) has the molecular formula C8H14FNO2S and a molecular weight of 207.27 g/mol. Its IUPAC name is 4-fluoro-N,N-dimethylhexa-2,4-diene-3-sulfonamide.
| Compound Name | 4-fluoro-N,N-dimethylhexa-2,4-diene-3-sulfonamide |
|---|---|
| PubChem CID | 90944446 |
| Molecular Formula | C8H14FNO2S |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 4-fluoro-N,N-dimethylhexa-2,4-diene-3-sulfonamide |
| SMILES | CC=C(F)C(=CC)S(=O)(=O)N(C)C |
| InChI | InChI=1S/C8H14FNO2S/c1-5-7(9)8(6-2)13(11,12)10(3)4/h5-6H,1-4H3 |
| InChIKey | NCXZJRZOTHGTQK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|