C13H24FNO2S — CID 143393015
(2E,5E)-5-fluoro-N-methyl-N-pentylhepta-2,5-diene-3-sulfonamide (PubChem CID 143393015) has the molecular formula C13H24FNO2S and a molecular weight of 277.40 g/mol. Its IUPAC name is (2E,5E)-5-fluoro-N-methyl-N-pentylhepta-2,5-diene-3-sulfonamide.
| Compound Name | (2E,5E)-5-fluoro-N-methyl-N-pentylhepta-2,5-diene-3-sulfonamide |
|---|---|
| PubChem CID | 143393015 |
| Molecular Formula | C13H24FNO2S |
| Molecular Weight | 277.40 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | (2E,5E)-5-fluoro-N-methyl-N-pentylhepta-2,5-diene-3-sulfonamide |
| SMILES | C/C=C(/F)C/C(=C\C)S(=O)(=O)N(C)CCCCC |
| InChI | InChI=1S/C13H24FNO2S/c1-5-8-9-10-15(4)18(16,17)13(7-3)11-12(14)6-2/h6-7H,5,8-11H2,1-4H3/b12-6+,13-7+ |
| InChIKey | PZOPMGSTMOEXPO-PWHKKFIBSA-N |
| XLogP | 3.61 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|