C7H19NO3S — CID 174158325
N,N-dimethylbutan-1-amine;methanesulfonic acid (PubChem CID 174158325) has the molecular formula C7H19NO3S and a molecular weight of 197.30 g/mol. Its IUPAC name is N,N-dimethylbutan-1-amine;methanesulfonic acid.
| Compound Name | N,N-dimethylbutan-1-amine;methanesulfonic acid |
|---|---|
| PubChem CID | 174158325 |
| Molecular Formula | C7H19NO3S |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | N,N-dimethylbutan-1-amine;methanesulfonic acid |
| SMILES | CCCCN(C)C.CS(=O)(=O)O |
| InChI | InChI=1S/C6H15N.CH4O3S/c1-4-5-6-7(2)3;1-5(2,3)4/h4-6H2,1-3H3;1H3,(H,2,3,4) |
| InChIKey | OPHSEQBPZNXFOQ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|