C6H9F — CID 13165650
(3E)-3-fluoro-2-methylpenta-1,3-diene (PubChem CID 13165650) has the molecular formula C6H9F and a molecular weight of 100.14 g/mol. Its IUPAC name is (3E)-3-fluoro-2-methylpenta-1,3-diene.
| Compound Name | (3E)-3-fluoro-2-methylpenta-1,3-diene |
|---|---|
| PubChem CID | 13165650 |
| Molecular Formula | C6H9F |
| Molecular Weight | 100.14 g/mol |
| Exact Mass | 100.07 |
| IUPAC Name | (3E)-3-fluoro-2-methylpenta-1,3-diene |
| SMILES | C=C(C)/C(F)=C\C |
| InChI | InChI=1S/C6H9F/c1-4-6(7)5(2)3/h4H,2H2,1,3H3/b6-4+ |
| InChIKey | DXYQMEXICHRFCN-GQCTYLIASA-N |
| XLogP | 2.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 100.14 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|