C9H14F2 — CID 143383113
(3E)-2,3-difluoro-5-methylhexa-1,3,5-triene;ethane (PubChem CID 143383113) has the molecular formula C9H14F2 and a molecular weight of 160.21 g/mol. Its IUPAC name is (3E)-2,3-difluoro-5-methylhexa-1,3,5-triene;ethane.
| Compound Name | (3E)-2,3-difluoro-5-methylhexa-1,3,5-triene;ethane |
|---|---|
| PubChem CID | 143383113 |
| Molecular Formula | C9H14F2 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | (3E)-2,3-difluoro-5-methylhexa-1,3,5-triene;ethane |
| SMILES | C=C(C)/C=C(/F)C(=C)F.CC |
| InChI | InChI=1S/C7H8F2.C2H6/c1-5(2)4-7(9)6(3)8;1-2/h4H,1,3H2,2H3;1-2H3/b7-4+; |
| InChIKey | WXKOKJBFTSNMFW-KQGICBIGSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|