C9H13FO — CID 145002435
(2E,4E)-5-fluoro-2,6-dimethylhepta-2,4,6-trien-1-ol (PubChem CID 145002435) has the molecular formula C9H13FO and a molecular weight of 156.20 g/mol. Its IUPAC name is (2E,4E)-5-fluoro-2,6-dimethylhepta-2,4,6-trien-1-ol.
| Compound Name | (2E,4E)-5-fluoro-2,6-dimethylhepta-2,4,6-trien-1-ol |
|---|---|
| PubChem CID | 145002435 |
| Molecular Formula | C9H13FO |
| Molecular Weight | 156.20 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | (2E,4E)-5-fluoro-2,6-dimethylhepta-2,4,6-trien-1-ol |
| SMILES | C=C(C)/C(F)=C\C=C(/C)CO |
| InChI | InChI=1S/C9H13FO/c1-7(2)9(10)5-4-8(3)6-11/h4-5,11H,1,6H2,2-3H3/b8-4+,9-5+ |
| InChIKey | BGCBANWMDQXQNW-KBXRYBNXSA-N |
| XLogP | 2.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.20 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|