C14H26N2O — CID 143344506
ethane;1-[(3Z,5Z)-5-ethyl-3-methylhepta-1,3,5-trien-2-yl]-3-methylurea (PubChem CID 143344506) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is ethane;1-[(3Z,5Z)-5-ethyl-3-methylhepta-1,3,5-trien-2-yl]-3-methylurea.
| Compound Name | ethane;1-[(3Z,5Z)-5-ethyl-3-methylhepta-1,3,5-trien-2-yl]-3-methylurea |
|---|---|
| PubChem CID | 143344506 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | ethane;1-[(3Z,5Z)-5-ethyl-3-methylhepta-1,3,5-trien-2-yl]-3-methylurea |
| SMILES | C=C(NC(=O)NC)/C(C)=C\C(=C/C)CC.CC |
| InChI | InChI=1S/C12H20N2O.C2H6/c1-6-11(7-2)8-9(3)10(4)14-12(15)13-5;1-2/h6,8H,4,7H2,1-3,5H3,(H2,13,14,15);1-2H3/b9-8-,11-6-; |
| InChIKey | IODCNMLGSKRNIO-FKRDJXEBSA-N |
| XLogP | 3.76 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|