C10H14O — CID 143311273
(2E,4Z)-2-ethenyl-4-ethylhexa-2,4-dienal (PubChem CID 143311273) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is (2E,4Z)-2-ethenyl-4-ethylhexa-2,4-dienal.
| Compound Name | (2E,4Z)-2-ethenyl-4-ethylhexa-2,4-dienal |
|---|---|
| PubChem CID | 143311273 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | (2E,4Z)-2-ethenyl-4-ethylhexa-2,4-dienal |
| SMILES | C=C/C(C=O)=C\C(=C/C)CC |
| InChI | InChI=1S/C10H14O/c1-4-9(5-2)7-10(6-3)8-11/h4,6-8H,3,5H2,1-2H3/b9-4-,10-7+ |
| InChIKey | IQOSTOXBGXTXHI-SWSBUGGLSA-N |
| XLogP | 2.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|