C15H27NO2 — CID 144553341
ethane;N-[(2E,3E)-2-ethylidene-4-formylhexa-3,5-dienyl]acetamide (PubChem CID 144553341) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is ethane;N-[(2E,3E)-2-ethylidene-4-formylhexa-3,5-dienyl]acetamide.
| Compound Name | ethane;N-[(2E,3E)-2-ethylidene-4-formylhexa-3,5-dienyl]acetamide |
|---|---|
| PubChem CID | 144553341 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | ethane;N-[(2E,3E)-2-ethylidene-4-formylhexa-3,5-dienyl]acetamide |
| SMILES | C=C/C(C=O)=C\C(=C/C)CNC(C)=O.CC.CC |
| InChI | InChI=1S/C11H15NO2.2C2H6/c1-4-10(7-12-9(3)14)6-11(5-2)8-13;2*1-2/h4-6,8H,2,7H2,1,3H3,(H,12,14);2*1-2H3/b10-4+,11-6+;; |
| InChIKey | PUDZXHQBTFCTIO-YBOYMTSTSA-N |
| XLogP | 3.43 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|