C14H22O — CID 153339375
(Z,2E,5Z)-2,5-di(ethylidene)-7-methylnon-3-enal (PubChem CID 153339375) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is (Z,2E,5Z)-2,5-di(ethylidene)-7-methylnon-3-enal.
| Compound Name | (Z,2E,5Z)-2,5-di(ethylidene)-7-methylnon-3-enal |
|---|---|
| PubChem CID | 153339375 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | (Z,2E,5Z)-2,5-di(ethylidene)-7-methylnon-3-enal |
| SMILES | C/C=C(\C=C/C(C=O)=C\C)CC(C)CC |
| InChI | InChI=1S/C14H22O/c1-5-12(4)10-13(6-2)8-9-14(7-3)11-15/h6-9,11-12H,5,10H2,1-4H3/b9-8-,13-6+,14-7+ |
| InChIKey | WWNBDDHPWXQQDZ-TZDILNBQSA-N |
| XLogP | 4.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|