(2E,4E)-4-ethylhexa-2,4-dienoic acid

C8H12O2 — CID 10942523

IUPAC(2E,4E)-4-ethylhexa-2,4-dienoic acid
SMILESC/C=C(/C=C/C(=O)O)CC
InChIInChI=1S/C8H12O2/c1-3-7(4-2)5-6-8(9)10/h3,5-6H,4H2,1-2H3,(H,9,10)/b6-5+,7-3+
InChIKeyONRFQULGRIAPJL-SIZYMYPJSA-N
MW140.18 g/mol
LogP1.98
Rot. Bonds3

About (2E,4E)-4-ethylhexa-2,4-dienoic acid

(2E,4E)-4-ethylhexa-2,4-dienoic acid (PubChem CID 10942523) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is (2E,4E)-4-ethylhexa-2,4-dienoic acid.

Molecular Properties

Compound Name(2E,4E)-4-ethylhexa-2,4-dienoic acid
PubChem CID10942523
Molecular FormulaC8H12O2
Molecular Weight140.18 g/mol
Exact Mass140.08
IUPAC Name(2E,4E)-4-ethylhexa-2,4-dienoic acid
SMILESC/C=C(/C=C/C(=O)O)CC
InChIInChI=1S/C8H12O2/c1-3-7(4-2)5-6-8(9)10/h3,5-6H,4H2,1-2H3,(H,9,10)/b6-5+,7-3+
InChIKeyONRFQULGRIAPJL-SIZYMYPJSA-N
XLogP1.98
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500140.18
LogP ≤ 51.98
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (2E,4E)-4-ethylhexa-2,4-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2E,4E)-4-ethylhexa-2,4-dienoic acid?
The IUPAC name of (2E,4E)-4-ethylhexa-2,4-dienoic acid (CID 10942523) is (2E,4E)-4-ethylhexa-2,4-dienoic acid.
What is the SMILES notation for (2E,4E)-4-ethylhexa-2,4-dienoic acid?
The canonical SMILES for (2E,4E)-4-ethylhexa-2,4-dienoic acid is C/C=C(/C=C/C(=O)O)CC.
What is the InChIKey of (2E,4E)-4-ethylhexa-2,4-dienoic acid?
The InChIKey is ONRFQULGRIAPJL-SIZYMYPJSA-N. The full InChI is InChI=1S/C8H12O2/c1-3-7(4-2)5-6-8(9)10/h3,5-6H,4H2,1-2H3,(H,9,10)/b6-5+,7-3+.
What are the key properties of (2E,4E)-4-ethylhexa-2,4-dienoic acid?
(2E,4E)-4-ethylhexa-2,4-dienoic acid has a molecular weight of 140.18 g/mol, XLogP of 1.98, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-4-ethylhexa-2,4-dienoic acid is sourced from PubChem (CID 10942523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).