About (Z)-but-2-enedioic acid;propanedithioic acid
(Z)-but-2-enedioic acid;propanedithioic acid (PubChem CID 174918117) has the molecular formula C7H10O4S2
and a molecular weight of 222.29 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;propanedithioic acid.
Molecular Properties
| Compound Name | (Z)-but-2-enedioic acid;propanedithioic acid |
| PubChem CID | 174918117 |
| Molecular Formula | C7H10O4S2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.00 |
| IUPAC Name | (Z)-but-2-enedioic acid;propanedithioic acid |
| SMILES | CCC(=S)S.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C4H4O4.C3H6S2/c5-3(6)1-2-4(7)8;1-2-3(4)5/h1-2H,(H,5,6)(H,7,8);2H2,1H3,(H,4,5)/b2-1-; |
| InChIKey | RRFVICHNMRNIDI-ODZAUARKSA-N |
| XLogP | 1.37 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-enedioic acid;propanedithioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-enedioic acid;propanedithioic acid?
The IUPAC name of (Z)-but-2-enedioic acid;propanedithioic acid (CID 174918117) is (Z)-but-2-enedioic acid;propanedithioic acid.
What is the SMILES notation for (Z)-but-2-enedioic acid;propanedithioic acid?
The canonical SMILES for (Z)-but-2-enedioic acid;propanedithioic acid is CCC(=S)S.O=C(O)/C=C\C(=O)O.
What is the InChIKey of (Z)-but-2-enedioic acid;propanedithioic acid?
The InChIKey is RRFVICHNMRNIDI-ODZAUARKSA-N. The full InChI is InChI=1S/C4H4O4.C3H6S2/c5-3(6)1-2-4(7)8;1-2-3(4)5/h1-2H,(H,5,6)(H,7,8);2H2,1H3,(H,4,5)/b2-1-;.
What are the key properties of (Z)-but-2-enedioic acid;propanedithioic acid?
(Z)-but-2-enedioic acid;propanedithioic acid has a molecular weight of 222.29 g/mol, XLogP of 1.37, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-enedioic acid;propanedithioic acid is sourced from PubChem (CID 174918117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).