C9H12O — CID 145355819
(2E)-2-ethenyl-5-methylhexa-2,5-dienal (PubChem CID 145355819) has the molecular formula C9H12O and a molecular weight of 136.19 g/mol. Its IUPAC name is (2E)-2-ethenyl-5-methylhexa-2,5-dienal.
| Compound Name | (2E)-2-ethenyl-5-methylhexa-2,5-dienal |
|---|---|
| PubChem CID | 145355819 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | (2E)-2-ethenyl-5-methylhexa-2,5-dienal |
| SMILES | C=C/C(C=O)=C\CC(=C)C |
| InChI | InChI=1S/C9H12O/c1-4-9(7-10)6-5-8(2)3/h4,6-7H,1-2,5H2,3H3/b9-6+ |
| InChIKey | BROYIEWXPRWBHG-RMKNXTFCSA-N |
| XLogP | 2.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|