C13H20 — CID 123708216
6-ethyl-2-methyl-4-methylidenenona-1,5,7-triene (PubChem CID 123708216) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is 6-ethyl-2-methyl-4-methylidenenona-1,5,7-triene.
| Compound Name | 6-ethyl-2-methyl-4-methylidenenona-1,5,7-triene |
|---|---|
| PubChem CID | 123708216 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | 6-ethyl-2-methyl-4-methylidenenona-1,5,7-triene |
| SMILES | C=C(C)CC(=C)C=C(C=CC)CC |
| InChI | InChI=1S/C13H20/c1-6-8-13(7-2)10-12(5)9-11(3)4/h6,8,10H,3,5,7,9H2,1-2,4H3 |
| InChIKey | OWOWFPMSPCGNCB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|