C11H18O — CID 100961260
(1Z,3E,5E)-3-ethyl-1-methoxy-5-methylhepta-1,3,5-triene (PubChem CID 100961260) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is (1Z,3E,5E)-3-ethyl-1-methoxy-5-methylhepta-1,3,5-triene.
| Compound Name | (1Z,3E,5E)-3-ethyl-1-methoxy-5-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 100961260 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (1Z,3E,5E)-3-ethyl-1-methoxy-5-methylhepta-1,3,5-triene |
| SMILES | C/C=C(C)/C=C(/C=C\OC)CC |
| InChI | InChI=1S/C11H18O/c1-5-10(3)9-11(6-2)7-8-12-4/h5,7-9H,6H2,1-4H3/b8-7-,10-5+,11-9+ |
| InChIKey | YJXJLRBOGLNDGA-JGRQPKPISA-N |
| XLogP | 3.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|