C12H18O2 — CID 143328964
(5Z,7Z)-5-[(E)-2-methoxyethenyl]nona-5,7-dien-2-one (PubChem CID 143328964) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is (5Z,7Z)-5-[(E)-2-methoxyethenyl]nona-5,7-dien-2-one.
| Compound Name | (5Z,7Z)-5-[(E)-2-methoxyethenyl]nona-5,7-dien-2-one |
|---|---|
| PubChem CID | 143328964 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (5Z,7Z)-5-[(E)-2-methoxyethenyl]nona-5,7-dien-2-one |
| SMILES | C/C=C\C=C(/C=C/OC)CCC(C)=O |
| InChI | InChI=1S/C12H18O2/c1-4-5-6-12(9-10-14-3)8-7-11(2)13/h4-6,9-10H,7-8H2,1-3H3/b5-4-,10-9+,12-6- |
| InChIKey | ILDQCNYBAKAEFG-NOBOLRJRSA-N |
| XLogP | 3.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|