C5H7O2Se — CID 59102011
CID 59102011 (PubChem CID 59102011) has the molecular formula C5H7O2Se and a molecular weight of 178.07 g/mol.
| Compound Name | CID 59102011 |
|---|---|
| PubChem CID | 59102011 |
| Molecular Formula | C5H7O2Se |
| Molecular Weight | 178.07 g/mol |
| Exact Mass | 178.96 |
| IUPAC Name | — |
| SMILES | CC(=O)CCC(=O)[Se] |
| InChI | InChI=1S/C5H7O2Se/c1-4(6)2-3-5(7)8/h2-3H2,1H3 |
| InChIKey | FSCVZZZISHYYFU-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.07 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|