C6H12O2P+ — CID 89067347
methyl-oxo-(4-oxopentyl)phosphanium (PubChem CID 89067347) has the molecular formula C6H12O2P+ and a molecular weight of 147.13 g/mol. Its IUPAC name is methyl-oxo-(4-oxopentyl)phosphanium.
| Compound Name | methyl-oxo-(4-oxopentyl)phosphanium |
|---|---|
| PubChem CID | 89067347 |
| Molecular Formula | C6H12O2P+ |
| Molecular Weight | 147.13 g/mol |
| Exact Mass | 147.06 |
| IUPAC Name | methyl-oxo-(4-oxopentyl)phosphanium |
| SMILES | CC(=O)CCC[P+](C)=O |
| InChI | InChI=1S/C6H12O2P/c1-6(7)4-3-5-9(2)8/h3-5H2,1-2H3/q+1 |
| InChIKey | XFZCNKNEAHLXJV-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.13 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|