C6H11O3P — CID 11063118
oxido-oxo-(5-oxohexyl)phosphanium (PubChem CID 11063118) has the molecular formula C6H11O3P and a molecular weight of 162.12 g/mol. Its IUPAC name is oxido-oxo-(5-oxohexyl)phosphanium.
| Compound Name | oxido-oxo-(5-oxohexyl)phosphanium |
|---|---|
| PubChem CID | 11063118 |
| Molecular Formula | C6H11O3P |
| Molecular Weight | 162.12 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | oxido-oxo-(5-oxohexyl)phosphanium |
| SMILES | CC(=O)CCCC[P+](=O)[O-] |
| InChI | InChI=1S/C6H11O3P/c1-6(7)4-2-3-5-10(8)9/h2-5H2,1H3 |
| InChIKey | PUCVEGXWDYANSM-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.12 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|