C6H11NaO3P+ — CID 23707633
sodium oxido-oxo-(5-oxohexyl)phosphanium (PubChem CID 23707633) has the molecular formula C6H11NaO3P+ and a molecular weight of 185.11 g/mol. Its IUPAC name is sodium oxido-oxo-(5-oxohexyl)phosphanium.
| Compound Name | sodium oxido-oxo-(5-oxohexyl)phosphanium |
|---|---|
| PubChem CID | 23707633 |
| Molecular Formula | C6H11NaO3P+ |
| Molecular Weight | 185.11 g/mol |
| Exact Mass | 185.03 |
| IUPAC Name | sodium oxido-oxo-(5-oxohexyl)phosphanium |
| SMILES | CC(=O)CCCC[P+](=O)[O-].[Na+] |
| InChI | InChI=1S/C6H11O3P.Na/c1-6(7)4-2-3-5-10(8)9;/h2-5H2,1H3;/q;+1 |
| InChIKey | BCLGRPLFCBRETB-UHFFFAOYSA-N |
| XLogP | -2.15 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.11 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|