About disodium;3-phosphopropanoate
disodium;3-phosphopropanoate (PubChem CID 21232047) has the molecular formula C3H4Na2O4P+
and a molecular weight of 181.01 g/mol. Its IUPAC name is disodium;3-phosphopropanoate.
Molecular Properties
| Compound Name | disodium;3-phosphopropanoate |
| PubChem CID | 21232047 |
| Molecular Formula | C3H4Na2O4P+ |
| Molecular Weight | 181.01 g/mol |
| Exact Mass | 180.96 |
| IUPAC Name | disodium;3-phosphopropanoate |
| SMILES | O=C([O-])CC[P+](=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C3H5O4P.2Na/c4-3(5)1-2-8(6)7;;/h1-2H2,(H,4,5);;/q;2*+1/p-1 |
| InChIKey | LJORYZYCBBBPJL-UHFFFAOYSA-M |
| XLogP | -7.76 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.01 |
| LogP ≤ 5 | -7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze disodium;3-phosphopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;3-phosphopropanoate?
The IUPAC name of disodium;3-phosphopropanoate (CID 21232047) is disodium;3-phosphopropanoate.
What is the SMILES notation for disodium;3-phosphopropanoate?
The canonical SMILES for disodium;3-phosphopropanoate is O=C([O-])CC[P+](=O)[O-].[Na+].[Na+].
What is the InChIKey of disodium;3-phosphopropanoate?
The InChIKey is LJORYZYCBBBPJL-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H5O4P.2Na/c4-3(5)1-2-8(6)7;;/h1-2H2,(H,4,5);;/q;2*+1/p-1.
What are the key properties of disodium;3-phosphopropanoate?
disodium;3-phosphopropanoate has a molecular weight of 181.01 g/mol, XLogP of -7.76, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;3-phosphopropanoate is sourced from PubChem (CID 21232047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).