C6H11IO — CID 11390494
6-iodohexan-2-one (PubChem CID 11390494) has the molecular formula C6H11IO and a molecular weight of 226.06 g/mol. Its IUPAC name is 6-iodohexan-2-one.
| Compound Name | 6-iodohexan-2-one |
|---|---|
| PubChem CID | 11390494 |
| Molecular Formula | C6H11IO |
| Molecular Weight | 226.06 g/mol |
| Exact Mass | 225.99 |
| IUPAC Name | 6-iodohexan-2-one |
| SMILES | CC(=O)CCCCI |
| InChI | InChI=1S/C6H11IO/c1-6(8)4-2-3-5-7/h2-5H2,1H3 |
| InChIKey | DJUPAAZTISXZSF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.06 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|