C16H23ClN2O — CID 156824725
1-[(2E,3Z)-5-chloro-2-ethylidenehexa-3,5-dienyl]-3-[(1E,3E)-4-methylhexa-1,3-dienyl]urea (PubChem CID 156824725) has the molecular formula C16H23ClN2O and a molecular weight of 294.83 g/mol. Its IUPAC name is 1-[(2E,3Z)-5-chloro-2-ethylidenehexa-3,5-dienyl]-3-[(1E,3E)-4-methylhexa-1,3-dienyl]urea.
| Compound Name | 1-[(2E,3Z)-5-chloro-2-ethylidenehexa-3,5-dienyl]-3-[(1E,3E)-4-methylhexa-1,3-dienyl]urea |
|---|---|
| PubChem CID | 156824725 |
| Molecular Formula | C16H23ClN2O |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 1-[(2E,3Z)-5-chloro-2-ethylidenehexa-3,5-dienyl]-3-[(1E,3E)-4-methylhexa-1,3-dienyl]urea |
| SMILES | C=C(Cl)/C=C\C(=C/C)CNC(=O)N/C=C/C=C(\C)CC |
| InChI | InChI=1S/C16H23ClN2O/c1-5-13(3)8-7-11-18-16(20)19-12-15(6-2)10-9-14(4)17/h6-11H,4-5,12H2,1-3H3,(H2,18,19,20)/b10-9-,11-7+,13-8+,15-6+ |
| InChIKey | SYEWKHAIRPTRKC-VAWXEOHKSA-N |
| XLogP | 4.41 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|