C8H9ClO — CID 170108495
(2E,4Z)-6-chloro-2-methylhepta-2,4,6-trienal (PubChem CID 170108495) has the molecular formula C8H9ClO and a molecular weight of 156.61 g/mol. Its IUPAC name is (2E,4Z)-6-chloro-2-methylhepta-2,4,6-trienal.
| Compound Name | (2E,4Z)-6-chloro-2-methylhepta-2,4,6-trienal |
|---|---|
| PubChem CID | 170108495 |
| Molecular Formula | C8H9ClO |
| Molecular Weight | 156.61 g/mol |
| Exact Mass | 156.03 |
| IUPAC Name | (2E,4Z)-6-chloro-2-methylhepta-2,4,6-trienal |
| SMILES | C=C(Cl)/C=C\C=C(/C)C=O |
| InChI | InChI=1S/C8H9ClO/c1-7(6-10)4-3-5-8(2)9/h3-6H,2H2,1H3/b5-3-,7-4+ |
| InChIKey | JVCVIIDMRGQGKC-XKSOLRDRSA-N |
| XLogP | 2.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.61 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|