C20H22O2 — CID 76625907
2,6,11,15-tetramethylhexadeca-2,4,6,10,12,14-hexaen-8-ynedial (PubChem CID 76625907) has the molecular formula C20H22O2 and a molecular weight of 294.39 g/mol. Its IUPAC name is 2,6,11,15-tetramethylhexadeca-2,4,6,10,12,14-hexaen-8-ynedial.
| Compound Name | 2,6,11,15-tetramethylhexadeca-2,4,6,10,12,14-hexaen-8-ynedial |
|---|---|
| PubChem CID | 76625907 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 2,6,11,15-tetramethylhexadeca-2,4,6,10,12,14-hexaen-8-ynedial |
| SMILES | CC(C=CC=C(C)C=O)=CC#CC=C(C)C=CC=C(C)C=O |
| InChI | InChI=1S/C20H22O2/c1-17(11-7-13-19(3)15-21)9-5-6-10-18(2)12-8-14-20(4)16-22/h7-16H,1-4H3 |
| InChIKey | WMMJPAOSDUSZRK-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|