C11H18 — CID 142039521
(2Z,4Z,6Z)-3,4,6-trimethylocta-2,4,6-triene (PubChem CID 142039521) has the molecular formula C11H18 and a molecular weight of 150.26 g/mol. Its IUPAC name is (2Z,4Z,6Z)-3,4,6-trimethylocta-2,4,6-triene.
| Compound Name | (2Z,4Z,6Z)-3,4,6-trimethylocta-2,4,6-triene |
|---|---|
| PubChem CID | 142039521 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | (2Z,4Z,6Z)-3,4,6-trimethylocta-2,4,6-triene |
| SMILES | C/C=C(C)\C=C(C)/C(C)=C\C |
| InChI | InChI=1S/C11H18/c1-6-9(3)8-11(5)10(4)7-2/h6-8H,1-5H3/b9-6-,10-7-,11-8- |
| InChIKey | IPJAQBIBTRJVKD-PCBOLYSDSA-N |
| XLogP | 3.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|