C13H20 — CID 144541052
(2Z,4Z,6Z)-3,6-dimethyl-4-prop-1-en-2-ylocta-2,4,6-triene (PubChem CID 144541052) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is (2Z,4Z,6Z)-3,6-dimethyl-4-prop-1-en-2-ylocta-2,4,6-triene.
| Compound Name | (2Z,4Z,6Z)-3,6-dimethyl-4-prop-1-en-2-ylocta-2,4,6-triene |
|---|---|
| PubChem CID | 144541052 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | (2Z,4Z,6Z)-3,6-dimethyl-4-prop-1-en-2-ylocta-2,4,6-triene |
| SMILES | C=C(C)C(=C/C(C)=C\C)/C(C)=C\C |
| InChI | InChI=1S/C13H20/c1-7-11(5)9-13(10(3)4)12(6)8-2/h7-9H,3H2,1-2,4-6H3/b11-7-,12-8-,13-9- |
| InChIKey | UCQRUAJQVWNWPE-PFVBFNHDSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|