C9H15N — CID 142809579
(3E,5Z)-2,5-dimethylhepta-1,3,5-trien-3-amine (PubChem CID 142809579) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is (3E,5Z)-2,5-dimethylhepta-1,3,5-trien-3-amine.
| Compound Name | (3E,5Z)-2,5-dimethylhepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 142809579 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | (3E,5Z)-2,5-dimethylhepta-1,3,5-trien-3-amine |
| SMILES | C=C(C)/C(N)=C\C(C)=C/C |
| InChI | InChI=1S/C9H15N/c1-5-8(4)6-9(10)7(2)3/h5-6H,2,10H2,1,3-4H3/b8-5-,9-6+ |
| InChIKey | JAKBFQBPZZTZEL-LDFAFZTOSA-N |
| XLogP | 2.37 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|