C12H21N — CID 143941928
(3E)-5-tert-butyl-2-methylhepta-1,3,5-trien-3-amine (PubChem CID 143941928) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is (3E)-5-tert-butyl-2-methylhepta-1,3,5-trien-3-amine.
| Compound Name | (3E)-5-tert-butyl-2-methylhepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 143941928 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (3E)-5-tert-butyl-2-methylhepta-1,3,5-trien-3-amine |
| SMILES | C=C(C)/C(N)=C\C(=CC)C(C)(C)C |
| InChI | InChI=1S/C12H21N/c1-7-10(12(4,5)6)8-11(13)9(2)3/h7-8H,2,13H2,1,3-6H3/b10-7?,11-8+ |
| InChIKey | XIHREXGUGCORBV-WEUQBPLZSA-N |
| XLogP | 3.40 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|