C12H21N — CID 126590897
(2Z,4Z,6E)-6-tert-butylocta-2,4,6-trien-2-amine (PubChem CID 126590897) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is (2Z,4Z,6E)-6-tert-butylocta-2,4,6-trien-2-amine.
| Compound Name | (2Z,4Z,6E)-6-tert-butylocta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 126590897 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (2Z,4Z,6E)-6-tert-butylocta-2,4,6-trien-2-amine |
| SMILES | C/C=C(\C=C/C=C(/C)N)C(C)(C)C |
| InChI | InChI=1S/C12H21N/c1-6-11(12(3,4)5)9-7-8-10(2)13/h6-9H,13H2,1-5H3/b9-7-,10-8-,11-6+ |
| InChIKey | UUUNXRDGJRXSDR-JFGTXHLYSA-N |
| XLogP | 3.40 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|