C11H20N2O — CID 171540295
[(2Z,4E)-4-tert-butylhexa-2,4-dienyl]urea (PubChem CID 171540295) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is [(2Z,4E)-4-tert-butylhexa-2,4-dienyl]urea.
| Compound Name | [(2Z,4E)-4-tert-butylhexa-2,4-dienyl]urea |
|---|---|
| PubChem CID | 171540295 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | [(2Z,4E)-4-tert-butylhexa-2,4-dienyl]urea |
| SMILES | C/C=C(\C=C/CNC(N)=O)C(C)(C)C |
| InChI | InChI=1S/C11H20N2O/c1-5-9(11(2,3)4)7-6-8-13-10(12)14/h5-7H,8H2,1-4H3,(H3,12,13,14)/b7-6-,9-5+ |
| InChIKey | WJYAFDFZXPNZMM-QRLJIZSYSA-N |
| XLogP | 2.20 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|