About [(2Z,4E)-4-tert-butylhexa-2,4-dienyl]urea
[(2Z,4E)-4-tert-butylhexa-2,4-dienyl]urea (PubChem CID 171540295) has the molecular formula C11H20N2O
and a molecular weight of 196.29 g/mol. Its IUPAC name is [(2Z,4E)-4-tert-butylhexa-2,4-dienyl]urea.
Molecular Properties
| Compound Name | [(2Z,4E)-4-tert-butylhexa-2,4-dienyl]urea |
| PubChem CID | 171540295 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | [(2Z,4E)-4-tert-butylhexa-2,4-dienyl]urea |
| SMILES | C/C=C(\C=C/CNC(N)=O)C(C)(C)C |
| InChI | InChI=1S/C11H20N2O/c1-5-9(11(2,3)4)7-6-8-13-10(12)14/h5-7H,8H2,1-4H3,(H3,12,13,14)/b7-6-,9-5+ |
| InChIKey | WJYAFDFZXPNZMM-QRLJIZSYSA-N |
| XLogP | 2.20 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(2Z,4E)-4-tert-butylhexa-2,4-dienyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2Z,4E)-4-tert-butylhexa-2,4-dienyl]urea?
The IUPAC name of [(2Z,4E)-4-tert-butylhexa-2,4-dienyl]urea (CID 171540295) is [(2Z,4E)-4-tert-butylhexa-2,4-dienyl]urea.
What is the SMILES notation for [(2Z,4E)-4-tert-butylhexa-2,4-dienyl]urea?
The canonical SMILES for [(2Z,4E)-4-tert-butylhexa-2,4-dienyl]urea is C/C=C(\C=C/CNC(N)=O)C(C)(C)C.
What is the InChIKey of [(2Z,4E)-4-tert-butylhexa-2,4-dienyl]urea?
The InChIKey is WJYAFDFZXPNZMM-QRLJIZSYSA-N. The full InChI is InChI=1S/C11H20N2O/c1-5-9(11(2,3)4)7-6-8-13-10(12)14/h5-7H,8H2,1-4H3,(H3,12,13,14)/b7-6-,9-5+.
What are the key properties of [(2Z,4E)-4-tert-butylhexa-2,4-dienyl]urea?
[(2Z,4E)-4-tert-butylhexa-2,4-dienyl]urea has a molecular weight of 196.29 g/mol, XLogP of 2.20, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(2Z,4E)-4-tert-butylhexa-2,4-dienyl]urea is sourced from PubChem (CID 171540295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).