C7H11F3N2O3 — CID 170912285
(E)-4-(methylamino)but-2-enamide;2,2,2-trifluoroacetic acid (PubChem CID 170912285) has the molecular formula C7H11F3N2O3 and a molecular weight of 228.17 g/mol. Its IUPAC name is (E)-4-(methylamino)but-2-enamide;2,2,2-trifluoroacetic acid.
| Compound Name | (E)-4-(methylamino)but-2-enamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 170912285 |
| Molecular Formula | C7H11F3N2O3 |
| Molecular Weight | 228.17 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | (E)-4-(methylamino)but-2-enamide;2,2,2-trifluoroacetic acid |
| SMILES | CNC/C=C/C(N)=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C5H10N2O.C2HF3O2/c1-7-4-2-3-5(6)8;3-2(4,5)1(6)7/h2-3,7H,4H2,1H3,(H2,6,8);(H,6,7)/b3-2+; |
| InChIKey | MYWATNXBSCMRNX-SQQVDAMQSA-N |
| XLogP | -0.12 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.17 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|