C8H14N2O — CID 143480404
(Z,2E)-2-ethylidene-5-(methylamino)pent-3-enamide (PubChem CID 143480404) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is (Z,2E)-2-ethylidene-5-(methylamino)pent-3-enamide.
| Compound Name | (Z,2E)-2-ethylidene-5-(methylamino)pent-3-enamide |
|---|---|
| PubChem CID | 143480404 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | (Z,2E)-2-ethylidene-5-(methylamino)pent-3-enamide |
| SMILES | C/C=C(\C=C/CNC)C(N)=O |
| InChI | InChI=1S/C8H14N2O/c1-3-7(8(9)11)5-4-6-10-2/h3-5,10H,6H2,1-2H3,(H2,9,11)/b5-4-,7-3+ |
| InChIKey | UBGMJOLFLRUPQI-SBYNAHCQSA-N |
| XLogP | 0.19 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|