C9H14N2O — CID 166872953
(2E,4Z)-2-[(E)-3-aminoprop-1-enyl]hexa-2,4-dienamide (PubChem CID 166872953) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is (2E,4Z)-2-[(E)-3-aminoprop-1-enyl]hexa-2,4-dienamide.
| Compound Name | (2E,4Z)-2-[(E)-3-aminoprop-1-enyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 166872953 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | (2E,4Z)-2-[(E)-3-aminoprop-1-enyl]hexa-2,4-dienamide |
| SMILES | C/C=C\C=C(/C=C/CN)C(N)=O |
| InChI | InChI=1S/C9H14N2O/c1-2-3-5-8(9(11)12)6-4-7-10/h2-6H,7,10H2,1H3,(H2,11,12)/b3-2-,6-4+,8-5+ |
| InChIKey | ASQFWJJZNUMSLG-PDDMAJEVSA-N |
| XLogP | 0.49 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|