C17H23NO — CID 140757697
2-prop-1-enyltetradeca-2,4,7,9,11-pentaenamide (PubChem CID 140757697) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is 2-prop-1-enyltetradeca-2,4,7,9,11-pentaenamide.
| Compound Name | 2-prop-1-enyltetradeca-2,4,7,9,11-pentaenamide |
|---|---|
| PubChem CID | 140757697 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 2-prop-1-enyltetradeca-2,4,7,9,11-pentaenamide |
| SMILES | CC=CC(=CC=CCC=CC=CC=CCC)C(N)=O |
| InChI | InChI=1S/C17H23NO/c1-3-5-6-7-8-9-10-11-12-13-15-16(14-4-2)17(18)19/h4-10,12-15H,3,11H2,1-2H3,(H2,18,19) |
| InChIKey | RHHAGUKIJYUHSY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|