C13H18N2 — CID 91282112
N-[3-but-1-enyl-2-(methylideneamino)hepta-1,3,5-trienyl]methanimine (PubChem CID 91282112) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is N-[3-but-1-enyl-2-(methylideneamino)hepta-1,3,5-trienyl]methanimine.
| Compound Name | N-[3-but-1-enyl-2-(methylideneamino)hepta-1,3,5-trienyl]methanimine |
|---|---|
| PubChem CID | 91282112 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | N-[3-but-1-enyl-2-(methylideneamino)hepta-1,3,5-trienyl]methanimine |
| SMILES | C=NC=C(N=C)C(C=CCC)=CC=CC |
| InChI | InChI=1S/C13H18N2/c1-5-7-9-12(10-8-6-2)13(15-4)11-14-3/h5,7-11H,3-4,6H2,1-2H3 |
| InChIKey | VGLPGFIVNJDRLK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|