C13H19N — CID 142143345
(E,2E,3Z)-3-ethylidene-N-methyl-2-prop-2-enylidenehept-4-en-1-imine (PubChem CID 142143345) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is (E,2E,3Z)-3-ethylidene-N-methyl-2-prop-2-enylidenehept-4-en-1-imine.
| Compound Name | (E,2E,3Z)-3-ethylidene-N-methyl-2-prop-2-enylidenehept-4-en-1-imine |
|---|---|
| PubChem CID | 142143345 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | (E,2E,3Z)-3-ethylidene-N-methyl-2-prop-2-enylidenehept-4-en-1-imine |
| SMILES | C=C/C=C(/C=N/C)C(=C/C)\C=C\CC |
| InChI | InChI=1S/C13H19N/c1-5-8-10-12(7-3)13(9-6-2)11-14-4/h6-11H,2,5H2,1,3-4H3/b10-8+,12-7-,13-9-,14-11+ |
| InChIKey | UDPYHPPUPZAQQG-QSEMLNTASA-N |
| XLogP | 3.71 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|