C12H16 — CID 142571328
(3Z,6Z)-4-ethenyl-5-methylidenenona-1,3,6-triene (PubChem CID 142571328) has the molecular formula C12H16 and a molecular weight of 160.26 g/mol. Its IUPAC name is (3Z,6Z)-4-ethenyl-5-methylidenenona-1,3,6-triene.
| Compound Name | (3Z,6Z)-4-ethenyl-5-methylidenenona-1,3,6-triene |
|---|---|
| PubChem CID | 142571328 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | (3Z,6Z)-4-ethenyl-5-methylidenenona-1,3,6-triene |
| SMILES | C=C/C=C(/C=C)C(=C)/C=C\CC |
| InChI | InChI=1S/C12H16/c1-5-8-10-11(4)12(7-3)9-6-2/h6-10H,2-5H2,1H3/b10-8-,12-9- |
| InChIKey | DUMFYRXXGXIKIH-GGXBSVTOSA-N |
| XLogP | 3.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|